C22H31N3O8 — CID 11798387
methyl 3-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-oxopropanoate (PubChem CID 11798387) has the molecular formula C22H31N3O8 and a molecular weight of 465.50 g/mol. Its IUPAC name is methyl 3-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-oxopropanoate.
| Compound Name | methyl 3-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 11798387 |
| Molecular Formula | C22H31N3O8 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | methyl 3-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-oxopropanoate |
| SMILES | COC(=O)C(NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C22H31N3O8/c1-13(2)11-16(24-22(30)33-12-15-9-7-6-8-10-15)18(26)25-17(21(29)32-5)19(27)23-14(3)20(28)31-4/h6-10,13-14,16-17H,11-12H2,1-5H3,(H,23,27)(H,24,30)(H,25,26)/t14-,16-,17?/m0/s1 |
| InChIKey | DYHSOLMEZIHSEP-CCWDIYBNSA-N |
| XLogP | 0.66 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|