C27H56O2Si2 — CID 11798527
tert-butyl-[(5S,6R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyltrideca-1,12-dien-6-yl]oxy-dimethylsilane (PubChem CID 11798527) has the molecular formula C27H56O2Si2 and a molecular weight of 468.92 g/mol. Its IUPAC name is tert-butyl-[(5S,6R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyltrideca-1,12-dien-6-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(5S,6R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyltrideca-1,12-dien-6-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11798527 |
| Molecular Formula | C27H56O2Si2 |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.38 |
| IUPAC Name | tert-butyl-[(5S,6R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyltrideca-1,12-dien-6-yl]oxy-dimethylsilane |
| SMILES | C=CCC[C@H](C)[C@@H](C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CCC=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O2Si2/c1-15-17-19-22(3)24(28-30(11,12)26(5,6)7)21-25(23(4)20-18-16-2)29-31(13,14)27(8,9)10/h15-16,22-25H,1-2,17-21H2,3-14H3/t22-,23-,24+,25+/m0/s1 |
| InChIKey | BOERNTZLCOVTMR-CXSMSNRLSA-N |
| XLogP | 9.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|