C29H46O5 — CID 11798740
[(1R,2S,5S,7R,8S,11R,14R,15R,17R)-5,7-dihydroxy-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-8-yl] acetate (PubChem CID 11798740) has the molecular formula C29H46O5 and a molecular weight of 474.68 g/mol. Its IUPAC name is [(1R,2S,5S,7R,8S,11R,14R,15R,17R)-5,7-dihydroxy-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-8-yl] acetate.
| Compound Name | [(1R,2S,5S,7R,8S,11R,14R,15R,17R)-5,7-dihydroxy-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-8-yl] acetate |
|---|---|
| PubChem CID | 11798740 |
| Molecular Formula | C29H46O5 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | [(1R,2S,5S,7R,8S,11R,14R,15R,17R)-5,7-dihydroxy-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-9-en-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C2[C@@H]3CC[C@H]([C@H](C)CCCC(C)C)[C@@]3(C)C[C@H]3O[C@@]23[C@@]2(C)CC[C@H](O)C[C@]12O |
| InChI | InChI=1S/C29H46O5/c1-17(2)8-7-9-18(3)21-10-11-22-23-14-24(33-19(4)30)28(32)15-20(31)12-13-27(28,6)29(23)25(34-29)16-26(21,22)5/h14,17-18,20-22,24-25,31-32H,7-13,15-16H2,1-6H3/t18-,20+,21-,22+,24+,25-,26-,27+,28+,29+/m1/s1 |
| InChIKey | CEJPYZZCYLZKRP-ANNVCDRBSA-N |
| XLogP | 5.18 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|