C24H30F3NO4Si — CID 11798960
8-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(2,2,2-trifluoroacetyl)spiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohexa-2,5-diene]-1'-one (PubChem CID 11798960) has the molecular formula C24H30F3NO4Si and a molecular weight of 481.59 g/mol. Its IUPAC name is 8-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(2,2,2-trifluoroacetyl)spiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohexa-2,5-diene]-1'-one.
| Compound Name | 8-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(2,2,2-trifluoroacetyl)spiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohexa-2,5-diene]-1'-one |
|---|---|
| PubChem CID | 11798960 |
| Molecular Formula | C24H30F3NO4Si |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 8-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(2,2,2-trifluoroacetyl)spiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohexa-2,5-diene]-1'-one |
| SMILES | COc1cc2c(cc1O[Si](C)(C)C(C)(C)C)CN(C(=O)C(F)(F)F)CCC21C=CC(=O)C=C1 |
| InChI | InChI=1S/C24H30F3NO4Si/c1-22(2,3)33(5,6)32-20-13-16-15-28(21(30)24(25,26)27)12-11-23(9-7-17(29)8-10-23)18(16)14-19(20)31-4/h7-10,13-14H,11-12,15H2,1-6H3 |
| InChIKey | CQQHDKMFDSVBKO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|