C24H23F2N5O4 — CID 11799023
4-[[2-[5-amino-2-(3-methylphenyl)-6-oxopyrimidin-1-yl]acetyl]amino]-2,2-difluoro-3-oxo-5-phenylpentanamide (PubChem CID 11799023) has the molecular formula C24H23F2N5O4 and a molecular weight of 483.48 g/mol. Its IUPAC name is 4-[[2-[5-amino-2-(3-methylphenyl)-6-oxopyrimidin-1-yl]acetyl]amino]-2,2-difluoro-3-oxo-5-phenylpentanamide.
| Compound Name | 4-[[2-[5-amino-2-(3-methylphenyl)-6-oxopyrimidin-1-yl]acetyl]amino]-2,2-difluoro-3-oxo-5-phenylpentanamide |
|---|---|
| PubChem CID | 11799023 |
| Molecular Formula | C24H23F2N5O4 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 4-[[2-[5-amino-2-(3-methylphenyl)-6-oxopyrimidin-1-yl]acetyl]amino]-2,2-difluoro-3-oxo-5-phenylpentanamide |
| SMILES | Cc1cccc(-c2ncc(N)c(=O)n2CC(=O)NC(Cc2ccccc2)C(=O)C(F)(F)C(N)=O)c1 |
| InChI | InChI=1S/C24H23F2N5O4/c1-14-6-5-9-16(10-14)21-29-12-17(27)22(34)31(21)13-19(32)30-18(11-15-7-3-2-4-8-15)20(33)24(25,26)23(28)35/h2-10,12,18H,11,13,27H2,1H3,(H2,28,35)(H,30,32) |
| InChIKey | LUAHLAHELOSEBD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 150.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|