C26H30FN3O5 — CID 11799031
6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexyl N-(1,3-benzodioxol-5-yl)carbamate (PubChem CID 11799031) has the molecular formula C26H30FN3O5 and a molecular weight of 483.54 g/mol. Its IUPAC name is 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexyl N-(1,3-benzodioxol-5-yl)carbamate.
| Compound Name | 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexyl N-(1,3-benzodioxol-5-yl)carbamate |
|---|---|
| PubChem CID | 11799031 |
| Molecular Formula | C26H30FN3O5 |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexyl N-(1,3-benzodioxol-5-yl)carbamate |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)OCCCCCCN1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C26H30FN3O5/c27-19-5-7-21-23(15-19)35-29-25(21)18-9-12-30(13-10-18)11-3-1-2-4-14-32-26(31)28-20-6-8-22-24(16-20)34-17-33-22/h5-8,15-16,18H,1-4,9-14,17H2,(H,28,31) |
| InChIKey | POLDHXYZYRGQIS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|