C23H24ClFN6O3 — CID 11799155
N-[4-(3-chloro-4-fluoroanilino)-7-(3-morpholin-4-ylpropoxy)pyrido[3,2-d]pyrimidin-6-yl]prop-2-enamide (PubChem CID 11799155) has the molecular formula C23H24ClFN6O3 and a molecular weight of 486.94 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-(3-morpholin-4-ylpropoxy)pyrido[3,2-d]pyrimidin-6-yl]prop-2-enamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-(3-morpholin-4-ylpropoxy)pyrido[3,2-d]pyrimidin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 11799155 |
| Molecular Formula | C23H24ClFN6O3 |
| Molecular Weight | 486.94 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-(3-morpholin-4-ylpropoxy)pyrido[3,2-d]pyrimidin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1nc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C23H24ClFN6O3/c1-2-20(32)29-22-19(34-9-3-6-31-7-10-33-11-8-31)13-18-21(30-22)23(27-14-26-18)28-15-4-5-17(25)16(24)12-15/h2,4-5,12-14H,1,3,6-11H2,(H,26,27,28)(H,29,30,32) |
| InChIKey | WUTKDVWWIGSHGA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.94 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|