C27H21NO8 — CID 11799167
(2R)-2-[(1,9,11-trihydroxy-3-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carbonyl)amino]propanoic acid (PubChem CID 11799167) has the molecular formula C27H21NO8 and a molecular weight of 487.46 g/mol. Its IUPAC name is (2R)-2-[(1,9,11-trihydroxy-3-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carbonyl)amino]propanoic acid.
| Compound Name | (2R)-2-[(1,9,11-trihydroxy-3-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 11799167 |
| Molecular Formula | C27H21NO8 |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | (2R)-2-[(1,9,11-trihydroxy-3-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carbonyl)amino]propanoic acid |
| SMILES | Cc1cc2c(c(O)c1C(=O)N[C@H](C)C(=O)O)-c1cc3c(cc1CC2)C(=O)c1c(O)cc(O)cc1C3=O |
| InChI | InChI=1S/C27H21NO8/c1-10-5-13-4-3-12-6-16-17(23(31)18-7-14(29)8-19(30)22(18)24(16)32)9-15(12)21(13)25(33)20(10)26(34)28-11(2)27(35)36/h5-9,11,29-30,33H,3-4H2,1-2H3,(H,28,34)(H,35,36)/t11-/m1/s1 |
| InChIKey | IJTPIEDUZGVBCP-LLVKDONJSA-N |
| XLogP | 2.86 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|