C26H33NO6S — CID 11799181
(2R,4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-N-cyclohexyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine (PubChem CID 11799181) has the molecular formula C26H33NO6S and a molecular weight of 487.62 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-N-cyclohexyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine.
| Compound Name | (2R,4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-N-cyclohexyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine |
|---|---|
| PubChem CID | 11799181 |
| Molecular Formula | C26H33NO6S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | (2R,4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-N-cyclohexyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](S(=O)(=O)c2ccccc2)[C@H]1NC1CCCCC1 |
| InChI | InChI=1S/C26H33NO6S/c1-30-26-22(27-19-13-7-3-8-14-19)24(34(28,29)20-15-9-4-10-16-20)23-21(32-26)17-31-25(33-23)18-11-5-2-6-12-18/h2,4-6,9-12,15-16,19,21-27H,3,7-8,13-14,17H2,1H3/t21-,22-,23-,24-,25-,26+/m1/s1 |
| InChIKey | DQZPRUSGUBZXOY-JVIQZWCRSA-N |
| XLogP | 3.61 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |