C28H42O4S2 — CID 11799749
2-[(1R,3S)-1,3-dimethyl-2-methylidenecyclohexyl]-2-[(E)-2-methyl-4-(2,3,5,6-tetramethoxyphenyl)but-2-enyl]-1,3-dithiane (PubChem CID 11799749) has the molecular formula C28H42O4S2 and a molecular weight of 506.77 g/mol. Its IUPAC name is 2-[(1R,3S)-1,3-dimethyl-2-methylidenecyclohexyl]-2-[(E)-2-methyl-4-(2,3,5,6-tetramethoxyphenyl)but-2-enyl]-1,3-dithiane.
| Compound Name | 2-[(1R,3S)-1,3-dimethyl-2-methylidenecyclohexyl]-2-[(E)-2-methyl-4-(2,3,5,6-tetramethoxyphenyl)but-2-enyl]-1,3-dithiane |
|---|---|
| PubChem CID | 11799749 |
| Molecular Formula | C28H42O4S2 |
| Molecular Weight | 506.77 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 2-[(1R,3S)-1,3-dimethyl-2-methylidenecyclohexyl]-2-[(E)-2-methyl-4-(2,3,5,6-tetramethoxyphenyl)but-2-enyl]-1,3-dithiane |
| SMILES | C=C1[C@@H](C)CCC[C@@]1(C)C1(C/C(C)=C/Cc2c(OC)c(OC)cc(OC)c2OC)SCCCS1 |
| InChI | InChI=1S/C28H42O4S2/c1-19(12-13-22-25(31-7)23(29-5)17-24(30-6)26(22)32-8)18-28(33-15-10-16-34-28)27(4)14-9-11-20(2)21(27)3/h12,17,20H,3,9-11,13-16,18H2,1-2,4-8H3/b19-12+/t20-,27+/m0/s1 |
| InChIKey | VEIDFPFCUQHVAO-SADCYNGESA-N |
| XLogP | 7.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.77 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|