C13H10F9N3O6S — CID 11799753
N-hydroxy-2-[(2-nitrophenyl)methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]acetamide (PubChem CID 11799753) has the molecular formula C13H10F9N3O6S and a molecular weight of 507.29 g/mol. Its IUPAC name is N-hydroxy-2-[(2-nitrophenyl)methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]acetamide.
| Compound Name | N-hydroxy-2-[(2-nitrophenyl)methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 11799753 |
| Molecular Formula | C13H10F9N3O6S |
| Molecular Weight | 507.29 g/mol |
| Exact Mass | 507.01 |
| IUPAC Name | N-hydroxy-2-[(2-nitrophenyl)methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]acetamide |
| SMILES | O=C(CN(Cc1ccccc1[N+](=O)[O-])S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)NO |
| InChI | InChI=1S/C13H10F9N3O6S/c14-10(15,12(18,19)20)11(16,17)13(21,22)32(30,31)24(6-9(26)23-27)5-7-3-1-2-4-8(7)25(28)29/h1-4,27H,5-6H2,(H,23,26) |
| InChIKey | ZHENEPVPETWBJM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|