C25H47N7O4 — CID 11799845
2-[3-[(5S,8S,11R)-11-nonyl-3,6,9,13-tetraoxo-8-propan-2-yl-1,4,7,10-tetrazacyclotridec-5-yl]propyl]guanidine (PubChem CID 11799845) has the molecular formula C25H47N7O4 and a molecular weight of 509.70 g/mol. Its IUPAC name is 2-[3-[(5S,8S,11R)-11-nonyl-3,6,9,13-tetraoxo-8-propan-2-yl-1,4,7,10-tetrazacyclotridec-5-yl]propyl]guanidine.
| Compound Name | 2-[3-[(5S,8S,11R)-11-nonyl-3,6,9,13-tetraoxo-8-propan-2-yl-1,4,7,10-tetrazacyclotridec-5-yl]propyl]guanidine |
|---|---|
| PubChem CID | 11799845 |
| Molecular Formula | C25H47N7O4 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.37 |
| IUPAC Name | 2-[3-[(5S,8S,11R)-11-nonyl-3,6,9,13-tetraoxo-8-propan-2-yl-1,4,7,10-tetrazacyclotridec-5-yl]propyl]guanidine |
| SMILES | CCCCCCCCC[C@@H]1CC(=O)NCC(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](C(C)C)C(=O)N1 |
| InChI | InChI=1S/C25H47N7O4/c1-4-5-6-7-8-9-10-12-18-15-20(33)29-16-21(34)31-19(13-11-14-28-25(26)27)23(35)32-22(17(2)3)24(36)30-18/h17-19,22H,4-16H2,1-3H3,(H,29,33)(H,30,36)(H,31,34)(H,32,35)(H4,26,27,28)/t18-,19+,22+/m1/s1 |
| InChIKey | YYYZEPJRTHDHFO-DXIQSLLYSA-N |
| XLogP | 0.81 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|