About 9,10-dichloroanthracene
9,10-dichloroanthracene (PubChem CID 11800) has the molecular formula C14H8Cl2
and a molecular weight of 247.12 g/mol. Its IUPAC name is 9,10-dichloroanthracene.
Molecular Properties
| Compound Name | 9,10-dichloroanthracene |
| PubChem CID | 11800 |
| Molecular Formula | C14H8Cl2 |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 9,10-dichloroanthracene |
| SMILES | Clc1c2ccccc2c(Cl)c2ccccc12 |
| InChI | InChI=1S/C14H8Cl2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8H |
| InChIKey | FKDIWXZNKAZCBY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9,10-dichloroanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dichloroanthracene?
The IUPAC name of 9,10-dichloroanthracene (CID 11800) is 9,10-dichloroanthracene.
What is the SMILES notation for 9,10-dichloroanthracene?
The canonical SMILES for 9,10-dichloroanthracene is Clc1c2ccccc2c(Cl)c2ccccc12.
What is the InChIKey of 9,10-dichloroanthracene?
The InChIKey is FKDIWXZNKAZCBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8H.
What are the key properties of 9,10-dichloroanthracene?
9,10-dichloroanthracene has a molecular weight of 247.12 g/mol, XLogP of 5.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dichloroanthracene is sourced from PubChem (CID 11800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).