About 2-(2,2-dimethylbutanoyloxy)ethyl-[3-(dithiocarboxyamino)propyl]carbamodithioic acid
2-(2,2-dimethylbutanoyloxy)ethyl-[3-(dithiocarboxyamino)propyl]carbamodithioic acid (PubChem CID 118000302) has the molecular formula C13H24N2O2S4
and a molecular weight of 368.62 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethyl-[3-(dithiocarboxyamino)propyl]carbamodithioic acid.
Molecular Properties
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethyl-[3-(dithiocarboxyamino)propyl]carbamodithioic acid |
| PubChem CID | 118000302 |
| Molecular Formula | C13H24N2O2S4 |
| Molecular Weight | 368.62 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethyl-[3-(dithiocarboxyamino)propyl]carbamodithioic acid |
| SMILES | CCC(C)(C)C(=O)OCCN(CCCNC(=S)S)C(=S)S |
| InChI | InChI=1S/C13H24N2O2S4/c1-4-13(2,3)10(16)17-9-8-15(12(20)21)7-5-6-14-11(18)19/h4-9H2,1-3H3,(H,20,21)(H2,14,18,19) |
| InChIKey | HZUXKGKWUSPHKH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethylbutanoyloxy)ethyl-[3-(dithiocarboxyamino)propyl]carbamodithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylbutanoyloxy)ethyl-[3-(dithiocarboxyamino)propyl]carbamodithioic acid?
The IUPAC name of 2-(2,2-dimethylbutanoyloxy)ethyl-[3-(dithiocarboxyamino)propyl]carbamodithioic acid (CID 118000302) is 2-(2,2-dimethylbutanoyloxy)ethyl-[3-(dithiocarboxyamino)propyl]carbamodithioic acid.
What is the SMILES notation for 2-(2,2-dimethylbutanoyloxy)ethyl-[3-(dithiocarboxyamino)propyl]carbamodithioic acid?
The canonical SMILES for 2-(2,2-dimethylbutanoyloxy)ethyl-[3-(dithiocarboxyamino)propyl]carbamodithioic acid is CCC(C)(C)C(=O)OCCN(CCCNC(=S)S)C(=S)S.
What is the InChIKey of 2-(2,2-dimethylbutanoyloxy)ethyl-[3-(dithiocarboxyamino)propyl]carbamodithioic acid?
The InChIKey is HZUXKGKWUSPHKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O2S4/c1-4-13(2,3)10(16)17-9-8-15(12(20)21)7-5-6-14-11(18)19/h4-9H2,1-3H3,(H,20,21)(H2,14,18,19).
What are the key properties of 2-(2,2-dimethylbutanoyloxy)ethyl-[3-(dithiocarboxyamino)propyl]carbamodithioic acid?
2-(2,2-dimethylbutanoyloxy)ethyl-[3-(dithiocarboxyamino)propyl]carbamodithioic acid has a molecular weight of 368.62 g/mol, XLogP of 2.68, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylbutanoyloxy)ethyl-[3-(dithiocarboxyamino)propyl]carbamodithioic acid is sourced from PubChem (CID 118000302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).