About 5-nitro-4-(1-oxo-2,3-dihydroinden-4-yl)-2,3-dihydroinden-1-one
5-nitro-4-(1-oxo-2,3-dihydroinden-4-yl)-2,3-dihydroinden-1-one (PubChem CID 118000468) has the molecular formula C18H13NO4
and a molecular weight of 307.30 g/mol. Its IUPAC name is 5-nitro-4-(1-oxo-2,3-dihydroinden-4-yl)-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 5-nitro-4-(1-oxo-2,3-dihydroinden-4-yl)-2,3-dihydroinden-1-one |
| PubChem CID | 118000468 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 5-nitro-4-(1-oxo-2,3-dihydroinden-4-yl)-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2c1cccc2-c1c([N+](=O)[O-])ccc2c1CCC2=O |
| InChI | InChI=1S/C18H13NO4/c20-16-8-5-10-11(16)2-1-3-13(10)18-14-6-9-17(21)12(14)4-7-15(18)19(22)23/h1-4,7H,5-6,8-9H2 |
| InChIKey | SOPUIAOZZGGZNV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-4-(1-oxo-2,3-dihydroinden-4-yl)-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-4-(1-oxo-2,3-dihydroinden-4-yl)-2,3-dihydroinden-1-one?
The IUPAC name of 5-nitro-4-(1-oxo-2,3-dihydroinden-4-yl)-2,3-dihydroinden-1-one (CID 118000468) is 5-nitro-4-(1-oxo-2,3-dihydroinden-4-yl)-2,3-dihydroinden-1-one.
What is the SMILES notation for 5-nitro-4-(1-oxo-2,3-dihydroinden-4-yl)-2,3-dihydroinden-1-one?
The canonical SMILES for 5-nitro-4-(1-oxo-2,3-dihydroinden-4-yl)-2,3-dihydroinden-1-one is O=C1CCc2c1cccc2-c1c([N+](=O)[O-])ccc2c1CCC2=O.
What is the InChIKey of 5-nitro-4-(1-oxo-2,3-dihydroinden-4-yl)-2,3-dihydroinden-1-one?
The InChIKey is SOPUIAOZZGGZNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO4/c20-16-8-5-10-11(16)2-1-3-13(10)18-14-6-9-17(21)12(14)4-7-15(18)19(22)23/h1-4,7H,5-6,8-9H2.
What are the key properties of 5-nitro-4-(1-oxo-2,3-dihydroinden-4-yl)-2,3-dihydroinden-1-one?
5-nitro-4-(1-oxo-2,3-dihydroinden-4-yl)-2,3-dihydroinden-1-one has a molecular weight of 307.30 g/mol, XLogP of 3.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-4-(1-oxo-2,3-dihydroinden-4-yl)-2,3-dihydroinden-1-one is sourced from PubChem (CID 118000468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).