About [3-[[methyl-[3-(4-oxochromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate
[3-[[methyl-[3-(4-oxochromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate (PubChem CID 11800049) has the molecular formula C28H36N2O5
and a molecular weight of 480.61 g/mol. Its IUPAC name is [3-[[methyl-[3-(4-oxochromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate.
Molecular Properties
| Compound Name | [3-[[methyl-[3-(4-oxochromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate |
| PubChem CID | 11800049 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | [3-[[methyl-[3-(4-oxochromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate |
| SMILES | CCCCCCCNC(=O)Oc1cccc(CN(C)CCCOc2ccc3c(=O)ccoc3c2)c1 |
| InChI | InChI=1S/C28H36N2O5/c1-3-4-5-6-7-15-29-28(32)35-24-11-8-10-22(19-24)21-30(2)16-9-17-33-23-12-13-25-26(31)14-18-34-27(25)20-23/h8,10-14,18-20H,3-7,9,15-17,21H2,1-2H3,(H,29,32) |
| InChIKey | WXDDXVCVTMPRSH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-[[methyl-[3-(4-oxochromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[methyl-[3-(4-oxochromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate?
The IUPAC name of [3-[[methyl-[3-(4-oxochromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate (CID 11800049) is [3-[[methyl-[3-(4-oxochromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate.
What is the SMILES notation for [3-[[methyl-[3-(4-oxochromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate?
The canonical SMILES for [3-[[methyl-[3-(4-oxochromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate is CCCCCCCNC(=O)Oc1cccc(CN(C)CCCOc2ccc3c(=O)ccoc3c2)c1.
What is the InChIKey of [3-[[methyl-[3-(4-oxochromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate?
The InChIKey is WXDDXVCVTMPRSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H36N2O5/c1-3-4-5-6-7-15-29-28(32)35-24-11-8-10-22(19-24)21-30(2)16-9-17-33-23-12-13-25-26(31)14-18-34-27(25)20-23/h8,10-14,18-20H,3-7,9,15-17,21H2,1-2H3,(H,29,32).
What are the key properties of [3-[[methyl-[3-(4-oxochromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate?
[3-[[methyl-[3-(4-oxochromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate has a molecular weight of 480.61 g/mol, XLogP of 5.75, 14 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[methyl-[3-(4-oxochromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate is sourced from PubChem (CID 11800049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).