About 1-butylimidazole;1H-imidazole-5-carboxylic acid
1-butylimidazole;1H-imidazole-5-carboxylic acid (PubChem CID 118000615) has the molecular formula C11H16N4O2
and a molecular weight of 236.28 g/mol. Its IUPAC name is 1-butylimidazole;1H-imidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-butylimidazole;1H-imidazole-5-carboxylic acid |
| PubChem CID | 118000615 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-butylimidazole;1H-imidazole-5-carboxylic acid |
| SMILES | CCCCn1ccnc1.O=C(O)c1cnc[nH]1 |
| InChI | InChI=1S/C7H12N2.C4H4N2O2/c1-2-3-5-9-6-4-8-7-9;7-4(8)3-1-5-2-6-3/h4,6-7H,2-3,5H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | HLVVIXJLKGOCHX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butylimidazole;1H-imidazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylimidazole;1H-imidazole-5-carboxylic acid?
The IUPAC name of 1-butylimidazole;1H-imidazole-5-carboxylic acid (CID 118000615) is 1-butylimidazole;1H-imidazole-5-carboxylic acid.
What is the SMILES notation for 1-butylimidazole;1H-imidazole-5-carboxylic acid?
The canonical SMILES for 1-butylimidazole;1H-imidazole-5-carboxylic acid is CCCCn1ccnc1.O=C(O)c1cnc[nH]1.
What is the InChIKey of 1-butylimidazole;1H-imidazole-5-carboxylic acid?
The InChIKey is HLVVIXJLKGOCHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.C4H4N2O2/c1-2-3-5-9-6-4-8-7-9;7-4(8)3-1-5-2-6-3/h4,6-7H,2-3,5H2,1H3;1-2H,(H,5,6)(H,7,8).
What are the key properties of 1-butylimidazole;1H-imidazole-5-carboxylic acid?
1-butylimidazole;1H-imidazole-5-carboxylic acid has a molecular weight of 236.28 g/mol, XLogP of 1.79, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylimidazole;1H-imidazole-5-carboxylic acid is sourced from PubChem (CID 118000615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).