C34H47NO3 — CID 11800071
4-[2-[(3R,5R,8R,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethynyl]-N,N-diethylbenzamide (PubChem CID 11800071) has the molecular formula C34H47NO3 and a molecular weight of 517.75 g/mol. Its IUPAC name is 4-[2-[(3R,5R,8R,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethynyl]-N,N-diethylbenzamide.
| Compound Name | 4-[2-[(3R,5R,8R,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethynyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 11800071 |
| Molecular Formula | C34H47NO3 |
| Molecular Weight | 517.75 g/mol |
| Exact Mass | 517.36 |
| IUPAC Name | 4-[2-[(3R,5R,8R,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethynyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C#C[C@@]2(O)CC[C@@]3(C)[C@H](CC[C@@H]4[C@@H]3CC[C@]3(C)[C@@H](C(C)=O)CC[C@@H]43)C2)cc1 |
| InChI | InChI=1S/C34H47NO3/c1-6-35(7-2)31(37)25-10-8-24(9-11-25)16-19-34(38)21-20-32(4)26(22-34)12-13-27-29-15-14-28(23(3)36)33(29,5)18-17-30(27)32/h8-11,26-30,38H,6-7,12-15,17-18,20-22H2,1-5H3/t26-,27+,28-,29+,30+,32+,33-,34-/m1/s1 |
| InChIKey | ZJWNIGOEBZYJRH-QOKZRWCOSA-N |
| XLogP | 6.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.75 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|