C24H10F4O6 — CID 118000718
5-[4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,2,2-tetrafluoroethyl]phenyl]-2-benzofuran-1,3-dione (PubChem CID 118000718) has the molecular formula C24H10F4O6 and a molecular weight of 470.33 g/mol. Its IUPAC name is 5-[4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,2,2-tetrafluoroethyl]phenyl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,2,2-tetrafluoroethyl]phenyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 118000718 |
| Molecular Formula | C24H10F4O6 |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 5-[4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,2,2-tetrafluoroethyl]phenyl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(-c3ccc(C(F)(F)C(F)(F)c4ccc5c(c4)C(=O)OC5=O)cc3)ccc21 |
| InChI | InChI=1S/C24H10F4O6/c25-23(26,24(27,28)14-6-8-16-18(10-14)22(32)34-20(16)30)13-4-1-11(2-5-13)12-3-7-15-17(9-12)21(31)33-19(15)29/h1-10H |
| InChIKey | NUPBVHUJHKTMDY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|