C24H23NO3 — CID 118001155
(8R,13aS)-3-methoxy-8-phenyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-10,11-diol (PubChem CID 118001155) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is (8R,13aS)-3-methoxy-8-phenyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-10,11-diol.
| Compound Name | (8R,13aS)-3-methoxy-8-phenyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-10,11-diol |
|---|---|
| PubChem CID | 118001155 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (8R,13aS)-3-methoxy-8-phenyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-10,11-diol |
| SMILES | COc1ccc2c(c1)CCN1[C@H](c3ccccc3)c3cc(O)c(O)cc3C[C@@H]21 |
| InChI | InChI=1S/C24H23NO3/c1-28-18-7-8-19-16(11-18)9-10-25-21(19)12-17-13-22(26)23(27)14-20(17)24(25)15-5-3-2-4-6-15/h2-8,11,13-14,21,24,26-27H,9-10,12H2,1H3/t21-,24+/m0/s1 |
| InChIKey | ZTZRRXBICONRMJ-XUZZJYLKSA-N |
| XLogP | 4.35 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|