About 7-tert-butyl-2-ethyl-2,7-diazaspiro[4.5]decane
7-tert-butyl-2-ethyl-2,7-diazaspiro[4.5]decane (PubChem CID 118001208) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is 7-tert-butyl-2-ethyl-2,7-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 7-tert-butyl-2-ethyl-2,7-diazaspiro[4.5]decane |
| PubChem CID | 118001208 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 7-tert-butyl-2-ethyl-2,7-diazaspiro[4.5]decane |
| SMILES | CCN1CCC2(CCCN(C(C)(C)C)C2)C1 |
| InChI | InChI=1S/C14H28N2/c1-5-15-10-8-14(11-15)7-6-9-16(12-14)13(2,3)4/h5-12H2,1-4H3 |
| InChIKey | QDZDZFDROHKDJT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-tert-butyl-2-ethyl-2,7-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-2-ethyl-2,7-diazaspiro[4.5]decane?
The IUPAC name of 7-tert-butyl-2-ethyl-2,7-diazaspiro[4.5]decane (CID 118001208) is 7-tert-butyl-2-ethyl-2,7-diazaspiro[4.5]decane.
What is the SMILES notation for 7-tert-butyl-2-ethyl-2,7-diazaspiro[4.5]decane?
The canonical SMILES for 7-tert-butyl-2-ethyl-2,7-diazaspiro[4.5]decane is CCN1CCC2(CCCN(C(C)(C)C)C2)C1.
What is the InChIKey of 7-tert-butyl-2-ethyl-2,7-diazaspiro[4.5]decane?
The InChIKey is QDZDZFDROHKDJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2/c1-5-15-10-8-14(11-15)7-6-9-16(12-14)13(2,3)4/h5-12H2,1-4H3.
What are the key properties of 7-tert-butyl-2-ethyl-2,7-diazaspiro[4.5]decane?
7-tert-butyl-2-ethyl-2,7-diazaspiro[4.5]decane has a molecular weight of 224.39 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-2-ethyl-2,7-diazaspiro[4.5]decane is sourced from PubChem (CID 118001208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).