C22H23N3O2S — CID 118001443
10-[2-(diethylamino)ethyl]-13-(1,3-oxazol-2-yl)-12-thia-10-azatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2(6),7,11(15),13-pentaen-5-one (PubChem CID 118001443) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is 10-[2-(diethylamino)ethyl]-13-(1,3-oxazol-2-yl)-12-thia-10-azatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2(6),7,11(15),13-pentaen-5-one.
| Compound Name | 10-[2-(diethylamino)ethyl]-13-(1,3-oxazol-2-yl)-12-thia-10-azatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2(6),7,11(15),13-pentaen-5-one |
|---|---|
| PubChem CID | 118001443 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 10-[2-(diethylamino)ethyl]-13-(1,3-oxazol-2-yl)-12-thia-10-azatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2(6),7,11(15),13-pentaen-5-one |
| SMILES | CCN(CC)CCn1c2ccc3c(c2c2cc(-c4ncco4)sc21)CCC3=O |
| InChI | InChI=1S/C22H23N3O2S/c1-3-24(4-2)10-11-25-17-7-5-14-15(6-8-18(14)26)20(17)16-13-19(28-22(16)25)21-23-9-12-27-21/h5,7,9,12-13H,3-4,6,8,10-11H2,1-2H3 |
| InChIKey | PDGVUTNHOCUVSO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |