C7H11F3N2 — CID 118002011
1,1,1-trifluoro-2-N,4-N-dimethylpentane-2,4-diimine (PubChem CID 118002011) has the molecular formula C7H11F3N2 and a molecular weight of 180.17 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-N,4-N-dimethylpentane-2,4-diimine.
| Compound Name | 1,1,1-trifluoro-2-N,4-N-dimethylpentane-2,4-diimine |
|---|---|
| PubChem CID | 118002011 |
| Molecular Formula | C7H11F3N2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 1,1,1-trifluoro-2-N,4-N-dimethylpentane-2,4-diimine |
| SMILES | C/N=C(\C)C/C(=N\C)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2/c1-5(11-2)4-6(12-3)7(8,9)10/h4H2,1-3H3/b11-5+,12-6+ |
| InChIKey | USGOAILTNSVGCJ-YDWXAUTNSA-N |
| XLogP | 2.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|