C8H17N5 — CID 118002806
5-imino-1,2-di(propan-2-yl)-1,2,4-triazol-3-amine (PubChem CID 118002806) has the molecular formula C8H17N5 and a molecular weight of 183.26 g/mol. Its IUPAC name is 5-imino-1,2-di(propan-2-yl)-1,2,4-triazol-3-amine.
| Compound Name | 5-imino-1,2-di(propan-2-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 118002806 |
| Molecular Formula | C8H17N5 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | 5-imino-1,2-di(propan-2-yl)-1,2,4-triazol-3-amine |
| SMILES | [H]/N=c1\nc(N)n(C(C)C)n1C(C)C |
| InChI | InChI=1S/C8H17N5/c1-5(2)12-7(9)11-8(10)13(12)6(3)4/h5-6H,1-4H3,(H3,9,10,11) |
| InChIKey | SQGIIVHNWSYMKN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 72.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |