C20H19FN6OS — CID 118002833
(16R)-19-amino-13-fluoro-4,8,16-trimethyl-17-oxa-9-thia-4,5,8,20-tetrazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2,5,10(15),11,13,18,20-octaene-3-carbonitrile (PubChem CID 118002833) has the molecular formula C20H19FN6OS and a molecular weight of 410.48 g/mol. Its IUPAC name is (16R)-19-amino-13-fluoro-4,8,16-trimethyl-17-oxa-9-thia-4,5,8,20-tetrazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2,5,10(15),11,13,18,20-octaene-3-carbonitrile.
| Compound Name | (16R)-19-amino-13-fluoro-4,8,16-trimethyl-17-oxa-9-thia-4,5,8,20-tetrazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2,5,10(15),11,13,18,20-octaene-3-carbonitrile |
|---|---|
| PubChem CID | 118002833 |
| Molecular Formula | C20H19FN6OS |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (16R)-19-amino-13-fluoro-4,8,16-trimethyl-17-oxa-9-thia-4,5,8,20-tetrazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2,5,10(15),11,13,18,20-octaene-3-carbonitrile |
| SMILES | C[C@H]1Oc2cc(cnc2N)-c2c(nn(C)c2C#N)CN(C)Sc2ccc(F)cc21 |
| InChI | InChI=1S/C20H19FN6OS/c1-11-14-7-13(21)4-5-18(14)29-26(2)10-15-19(16(8-22)27(3)25-15)12-6-17(28-11)20(23)24-9-12/h4-7,9,11H,10H2,1-3H3,(H2,23,24)/t11-/m1/s1 |
| InChIKey | WFYXDVGBGPSEST-LLVKDONJSA-N |
| XLogP | 3.67 |
| TPSA | 92.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|