C11H11FN2O4 — CID 118004692
6-ethynyl-5-[(2S,3S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrazin-2-one (PubChem CID 118004692) has the molecular formula C11H11FN2O4 and a molecular weight of 254.22 g/mol. Its IUPAC name is 6-ethynyl-5-[(2S,3S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrazin-2-one.
| Compound Name | 6-ethynyl-5-[(2S,3S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 118004692 |
| Molecular Formula | C11H11FN2O4 |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 6-ethynyl-5-[(2S,3S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrazin-2-one |
| SMILES | C#Cc1[nH]c(=O)cnc1[C@@H]1O[C@H](CO)C(O)[C@@H]1F |
| InChI | InChI=1S/C11H11FN2O4/c1-2-5-9(13-3-7(16)14-5)11-8(12)10(17)6(4-15)18-11/h1,3,6,8,10-11,15,17H,4H2,(H,14,16)/t6-,8+,10?,11-/m1/s1 |
| InChIKey | BDRFFMYURQFRCG-ANCVAQKZSA-N |
| XLogP | -1.12 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|