C13H14FNO4 — CID 118004918
5-[(2S,3S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-4-fluoro-6-prop-1-ynyl-1H-pyridin-2-one (PubChem CID 118004918) has the molecular formula C13H14FNO4 and a molecular weight of 267.26 g/mol. Its IUPAC name is 5-[(2S,3S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-4-fluoro-6-prop-1-ynyl-1H-pyridin-2-one.
| Compound Name | 5-[(2S,3S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-4-fluoro-6-prop-1-ynyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118004918 |
| Molecular Formula | C13H14FNO4 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 5-[(2S,3S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-4-fluoro-6-prop-1-ynyl-1H-pyridin-2-one |
| SMILES | CC#Cc1[nH]c(=O)cc(F)c1[C@@H]1O[C@H](C)C(O)[C@@H]1O |
| InChI | InChI=1S/C13H14FNO4/c1-3-4-8-10(7(14)5-9(16)15-8)13-12(18)11(17)6(2)19-13/h5-6,11-13,17-18H,1-2H3,(H,15,16)/t6-,11?,12+,13+/m1/s1 |
| InChIKey | VDPBVNWHPJIAGJ-DNVUKENOSA-N |
| XLogP | 0.07 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|