About 3-ethyl-6-methyl-1H-1,8-naphthyridin-2-one
3-ethyl-6-methyl-1H-1,8-naphthyridin-2-one (PubChem CID 118005009) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-ethyl-6-methyl-1H-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 3-ethyl-6-methyl-1H-1,8-naphthyridin-2-one |
| PubChem CID | 118005009 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 3-ethyl-6-methyl-1H-1,8-naphthyridin-2-one |
| SMILES | CCc1cc2cc(C)cnc2[nH]c1=O |
| InChI | InChI=1S/C11H12N2O/c1-3-8-5-9-4-7(2)6-12-10(9)13-11(8)14/h4-6H,3H2,1-2H3,(H,12,13,14) |
| InChIKey | HFAMGGZTKVRTDP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-6-methyl-1H-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6-methyl-1H-1,8-naphthyridin-2-one?
The IUPAC name of 3-ethyl-6-methyl-1H-1,8-naphthyridin-2-one (CID 118005009) is 3-ethyl-6-methyl-1H-1,8-naphthyridin-2-one.
What is the SMILES notation for 3-ethyl-6-methyl-1H-1,8-naphthyridin-2-one?
The canonical SMILES for 3-ethyl-6-methyl-1H-1,8-naphthyridin-2-one is CCc1cc2cc(C)cnc2[nH]c1=O.
What is the InChIKey of 3-ethyl-6-methyl-1H-1,8-naphthyridin-2-one?
The InChIKey is HFAMGGZTKVRTDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-3-8-5-9-4-7(2)6-12-10(9)13-11(8)14/h4-6H,3H2,1-2H3,(H,12,13,14).
What are the key properties of 3-ethyl-6-methyl-1H-1,8-naphthyridin-2-one?
3-ethyl-6-methyl-1H-1,8-naphthyridin-2-one has a molecular weight of 188.23 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6-methyl-1H-1,8-naphthyridin-2-one is sourced from PubChem (CID 118005009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).