C25H43FN2O5 — CID 118005222
2-butoxy-5-[(2S,3R,5R)-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]-4-fluoropyrimidine (PubChem CID 118005222) has the molecular formula C25H43FN2O5 and a molecular weight of 470.63 g/mol. Its IUPAC name is 2-butoxy-5-[(2S,3R,5R)-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]-4-fluoropyrimidine.
| Compound Name | 2-butoxy-5-[(2S,3R,5R)-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]-4-fluoropyrimidine |
|---|---|
| PubChem CID | 118005222 |
| Molecular Formula | C25H43FN2O5 |
| Molecular Weight | 470.63 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | 2-butoxy-5-[(2S,3R,5R)-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]-4-fluoropyrimidine |
| SMILES | CCCCOC[C@H]1O[C@@H](c2cnc(OCCCC)nc2F)[C@@H](OCCCC)C1OCCCC |
| InChI | InChI=1S/C25H43FN2O5/c1-5-9-13-29-18-20-22(30-14-10-6-2)23(31-15-11-7-3)21(33-20)19-17-27-25(28-24(19)26)32-16-12-8-4/h17,20-23H,5-16,18H2,1-4H3/t20-,21+,22?,23-/m1/s1 |
| InChIKey | LMKBTGMYUVWYLD-HNTVYWHESA-N |
| XLogP | 5.42 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|