C14H16FNO4 — CID 118005319
5-[(2S,3R,5R)-3-fluoro-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-6-prop-1-ynyl-1H-pyridin-2-one (PubChem CID 118005319) has the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. Its IUPAC name is 5-[(2S,3R,5R)-3-fluoro-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-6-prop-1-ynyl-1H-pyridin-2-one.
| Compound Name | 5-[(2S,3R,5R)-3-fluoro-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-6-prop-1-ynyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118005319 |
| Molecular Formula | C14H16FNO4 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 5-[(2S,3R,5R)-3-fluoro-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-6-prop-1-ynyl-1H-pyridin-2-one |
| SMILES | CC#Cc1[nH]c(=O)ccc1[C@@H]1O[C@H](CO)C(OC)[C@@H]1F |
| InChI | InChI=1S/C14H16FNO4/c1-3-4-9-8(5-6-11(18)16-9)13-12(15)14(19-2)10(7-17)20-13/h5-6,10,12-14,17H,7H2,1-2H3,(H,16,18)/t10-,12-,13+,14?/m1/s1 |
| InChIKey | YTBUDGBMWODFIR-BKQLOGFTSA-N |
| XLogP | 0.53 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|