About 3-ethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione
3-ethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione (PubChem CID 118005412) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is 3-ethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione.
Molecular Properties
| Compound Name | 3-ethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione |
| PubChem CID | 118005412 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 3-ethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione |
| SMILES | CCc1cn2ccc(=O)[nH]c2nc1=O |
| InChI | InChI=1S/C9H9N3O2/c1-2-6-5-12-4-3-7(13)10-9(12)11-8(6)14/h3-5H,2H2,1H3,(H,10,11,13,14) |
| InChIKey | KDUOXNBRXITJQD-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
The IUPAC name of 3-ethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione (CID 118005412) is 3-ethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione.
What is the SMILES notation for 3-ethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
The canonical SMILES for 3-ethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione is CCc1cn2ccc(=O)[nH]c2nc1=O.
What is the InChIKey of 3-ethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
The InChIKey is KDUOXNBRXITJQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c1-2-6-5-12-4-3-7(13)10-9(12)11-8(6)14/h3-5H,2H2,1H3,(H,10,11,13,14).
What are the key properties of 3-ethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
3-ethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione has a molecular weight of 191.19 g/mol, XLogP of -0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione is sourced from PubChem (CID 118005412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).