About 2-butoxy-5-[(2R,4R,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-methylpyrimidine
2-butoxy-5-[(2R,4R,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-methylpyrimidine (PubChem CID 118005447) has the molecular formula C22H38N2O4
and a molecular weight of 394.56 g/mol. Its IUPAC name is 2-butoxy-5-[(2R,4R,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-methylpyrimidine.
Molecular Properties
| Compound Name | 2-butoxy-5-[(2R,4R,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-methylpyrimidine |
| PubChem CID | 118005447 |
| Molecular Formula | C22H38N2O4 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.28 |
| IUPAC Name | 2-butoxy-5-[(2R,4R,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-methylpyrimidine |
| SMILES | CCCCOC[C@H]1O[C@@H](c2cnc(OCCCC)nc2C)C[C@H]1OCCCC |
| InChI | InChI=1S/C22H38N2O4/c1-5-8-11-25-16-21-20(26-12-9-6-2)14-19(28-21)18-15-23-22(24-17(18)4)27-13-10-7-3/h15,19-21H,5-14,16H2,1-4H3/t19-,20-,21-/m1/s1 |
| InChIKey | CVJHGKXMVBACHG-NJDAHSKKSA-N |
| XLogP | 4.80 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-5-[(2R,4R,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-5-[(2R,4R,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-methylpyrimidine?
The IUPAC name of 2-butoxy-5-[(2R,4R,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-methylpyrimidine (CID 118005447) is 2-butoxy-5-[(2R,4R,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-methylpyrimidine.
What is the SMILES notation for 2-butoxy-5-[(2R,4R,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-methylpyrimidine?
The canonical SMILES for 2-butoxy-5-[(2R,4R,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-methylpyrimidine is CCCCOC[C@H]1O[C@@H](c2cnc(OCCCC)nc2C)C[C@H]1OCCCC.
What is the InChIKey of 2-butoxy-5-[(2R,4R,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-methylpyrimidine?
The InChIKey is CVJHGKXMVBACHG-NJDAHSKKSA-N. The full InChI is InChI=1S/C22H38N2O4/c1-5-8-11-25-16-21-20(26-12-9-6-2)14-19(28-21)18-15-23-22(24-17(18)4)27-13-10-7-3/h15,19-21H,5-14,16H2,1-4H3/t19-,20-,21-/m1/s1.
What are the key properties of 2-butoxy-5-[(2R,4R,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-methylpyrimidine?
2-butoxy-5-[(2R,4R,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-methylpyrimidine has a molecular weight of 394.56 g/mol, XLogP of 4.80, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-5-[(2R,4R,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-methylpyrimidine is sourced from PubChem (CID 118005447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).