About 2-[(1,4-diphenylpiperidin-4-yl)amino]-N-hydroxypyrimidine-5-carboxamide
2-[(1,4-diphenylpiperidin-4-yl)amino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 118005674) has the molecular formula C22H23N5O2
and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-[(1,4-diphenylpiperidin-4-yl)amino]-N-hydroxypyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 2-[(1,4-diphenylpiperidin-4-yl)amino]-N-hydroxypyrimidine-5-carboxamide |
| PubChem CID | 118005674 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-[(1,4-diphenylpiperidin-4-yl)amino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(NC2(c3ccccc3)CCN(c3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C22H23N5O2/c28-20(26-29)17-15-23-21(24-16-17)25-22(18-7-3-1-4-8-18)11-13-27(14-12-22)19-9-5-2-6-10-19/h1-10,15-16,29H,11-14H2,(H,26,28)(H,23,24,25) |
| InChIKey | GJGGYIQXDOFWCX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1,4-diphenylpiperidin-4-yl)amino]-N-hydroxypyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,4-diphenylpiperidin-4-yl)amino]-N-hydroxypyrimidine-5-carboxamide?
The IUPAC name of 2-[(1,4-diphenylpiperidin-4-yl)amino]-N-hydroxypyrimidine-5-carboxamide (CID 118005674) is 2-[(1,4-diphenylpiperidin-4-yl)amino]-N-hydroxypyrimidine-5-carboxamide.
What is the SMILES notation for 2-[(1,4-diphenylpiperidin-4-yl)amino]-N-hydroxypyrimidine-5-carboxamide?
The canonical SMILES for 2-[(1,4-diphenylpiperidin-4-yl)amino]-N-hydroxypyrimidine-5-carboxamide is O=C(NO)c1cnc(NC2(c3ccccc3)CCN(c3ccccc3)CC2)nc1.
What is the InChIKey of 2-[(1,4-diphenylpiperidin-4-yl)amino]-N-hydroxypyrimidine-5-carboxamide?
The InChIKey is GJGGYIQXDOFWCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N5O2/c28-20(26-29)17-15-23-21(24-16-17)25-22(18-7-3-1-4-8-18)11-13-27(14-12-22)19-9-5-2-6-10-19/h1-10,15-16,29H,11-14H2,(H,26,28)(H,23,24,25).
What are the key properties of 2-[(1,4-diphenylpiperidin-4-yl)amino]-N-hydroxypyrimidine-5-carboxamide?
2-[(1,4-diphenylpiperidin-4-yl)amino]-N-hydroxypyrimidine-5-carboxamide has a molecular weight of 389.46 g/mol, XLogP of 3.20, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,4-diphenylpiperidin-4-yl)amino]-N-hydroxypyrimidine-5-carboxamide is sourced from PubChem (CID 118005674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).