C23H22F2N6O3 — CID 118005922
2-[[1-[(2,6-difluorophenyl)carbamoyl]-4-phenylpiperidin-4-yl]amino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 118005922) has the molecular formula C23H22F2N6O3 and a molecular weight of 468.46 g/mol. Its IUPAC name is 2-[[1-[(2,6-difluorophenyl)carbamoyl]-4-phenylpiperidin-4-yl]amino]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[[1-[(2,6-difluorophenyl)carbamoyl]-4-phenylpiperidin-4-yl]amino]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118005922 |
| Molecular Formula | C23H22F2N6O3 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 2-[[1-[(2,6-difluorophenyl)carbamoyl]-4-phenylpiperidin-4-yl]amino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(NC2(c3ccccc3)CCN(C(=O)Nc3c(F)cccc3F)CC2)nc1 |
| InChI | InChI=1S/C23H22F2N6O3/c24-17-7-4-8-18(25)19(17)28-22(33)31-11-9-23(10-12-31,16-5-2-1-3-6-16)29-21-26-13-15(14-27-21)20(32)30-34/h1-8,13-14,34H,9-12H2,(H,28,33)(H,30,32)(H,26,27,29) |
| InChIKey | IJOCXFUZXSAWMI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 119.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|