About 3-bromo-2-(2,2-dibromoethenyl)phenol
3-bromo-2-(2,2-dibromoethenyl)phenol (PubChem CID 118005946) has the molecular formula C8H5Br3O
and a molecular weight of 356.84 g/mol. Its IUPAC name is 3-bromo-2-(2,2-dibromoethenyl)phenol.
Molecular Properties
| Compound Name | 3-bromo-2-(2,2-dibromoethenyl)phenol |
| PubChem CID | 118005946 |
| Molecular Formula | C8H5Br3O |
| Molecular Weight | 356.84 g/mol |
| Exact Mass | 353.79 |
| IUPAC Name | 3-bromo-2-(2,2-dibromoethenyl)phenol |
| SMILES | Oc1cccc(Br)c1C=C(Br)Br |
| InChI | InChI=1S/C8H5Br3O/c9-6-2-1-3-7(12)5(6)4-8(10)11/h1-4,12H |
| InChIKey | CDYHVGYAGOJYJD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.84 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-2-(2,2-dibromoethenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-(2,2-dibromoethenyl)phenol?
The IUPAC name of 3-bromo-2-(2,2-dibromoethenyl)phenol (CID 118005946) is 3-bromo-2-(2,2-dibromoethenyl)phenol.
What is the SMILES notation for 3-bromo-2-(2,2-dibromoethenyl)phenol?
The canonical SMILES for 3-bromo-2-(2,2-dibromoethenyl)phenol is Oc1cccc(Br)c1C=C(Br)Br.
What is the InChIKey of 3-bromo-2-(2,2-dibromoethenyl)phenol?
The InChIKey is CDYHVGYAGOJYJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Br3O/c9-6-2-1-3-7(12)5(6)4-8(10)11/h1-4,12H.
What are the key properties of 3-bromo-2-(2,2-dibromoethenyl)phenol?
3-bromo-2-(2,2-dibromoethenyl)phenol has a molecular weight of 356.84 g/mol, XLogP of 4.24, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-(2,2-dibromoethenyl)phenol is sourced from PubChem (CID 118005946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).