C26H22F7N3O2 — CID 11800611
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(4-fluorophenyl)-N,2-dimethyl-1-oxo-5,6,7,8-tetrahydro-2,7-naphthyridine-3-carboxamide (PubChem CID 11800611) has the molecular formula C26H22F7N3O2 and a molecular weight of 541.47 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(4-fluorophenyl)-N,2-dimethyl-1-oxo-5,6,7,8-tetrahydro-2,7-naphthyridine-3-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(4-fluorophenyl)-N,2-dimethyl-1-oxo-5,6,7,8-tetrahydro-2,7-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 11800611 |
| Molecular Formula | C26H22F7N3O2 |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(4-fluorophenyl)-N,2-dimethyl-1-oxo-5,6,7,8-tetrahydro-2,7-naphthyridine-3-carboxamide |
| SMILES | CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)c1c(-c2ccc(F)cc2)c2c(c(=O)n1C)CNCC2 |
| InChI | InChI=1S/C26H22F7N3O2/c1-35(13-14-9-16(25(28,29)30)11-17(10-14)26(31,32)33)24(38)22-21(15-3-5-18(27)6-4-15)19-7-8-34-12-20(19)23(37)36(22)2/h3-6,9-11,34H,7-8,12-13H2,1-2H3 |
| InChIKey | GLOXMXBXBNINLC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|