C16H20N2O2 — CID 118006697
(2R,6S)-4-(8-methoxyquinolin-5-yl)-2,6-dimethylmorpholine (PubChem CID 118006697) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is (2R,6S)-4-(8-methoxyquinolin-5-yl)-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-(8-methoxyquinolin-5-yl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 118006697 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (2R,6S)-4-(8-methoxyquinolin-5-yl)-2,6-dimethylmorpholine |
| SMILES | COc1ccc(N2C[C@@H](C)O[C@@H](C)C2)c2cccnc12 |
| InChI | InChI=1S/C16H20N2O2/c1-11-9-18(10-12(2)20-11)14-6-7-15(19-3)16-13(14)5-4-8-17-16/h4-8,11-12H,9-10H2,1-3H3/t11-,12+ |
| InChIKey | HXKFVVSVGBWHHW-TXEJJXNPSA-N |
| XLogP | 2.86 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|