C21H22F2N2O4S — CID 118006735
(E)-3-(3,4-difluorocyclopentyl)-N-[5-(hydroxymethyl)-2-pyridinyl]-2-(4-methylsulfonylphenyl)prop-2-enamide (PubChem CID 118006735) has the molecular formula C21H22F2N2O4S and a molecular weight of 436.48 g/mol. Its IUPAC name is (E)-3-(3,4-difluorocyclopentyl)-N-[5-(hydroxymethyl)-2-pyridinyl]-2-(4-methylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-difluorocyclopentyl)-N-[5-(hydroxymethyl)-2-pyridinyl]-2-(4-methylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 118006735 |
| Molecular Formula | C21H22F2N2O4S |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (E)-3-(3,4-difluorocyclopentyl)-N-[5-(hydroxymethyl)-2-pyridinyl]-2-(4-methylsulfonylphenyl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc(/C(=C\C2CC(F)C(F)C2)C(=O)Nc2ccc(CO)cn2)cc1 |
| InChI | InChI=1S/C21H22F2N2O4S/c1-30(28,29)16-5-3-15(4-6-16)17(8-14-9-18(22)19(23)10-14)21(27)25-20-7-2-13(12-26)11-24-20/h2-8,11,14,18-19,26H,9-10,12H2,1H3,(H,24,25,27)/b17-8+ |
| InChIKey | GJVSHKWJXTYQME-CAOOACKPSA-N |
| XLogP | 3.09 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|