About [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-phenylcarbamate
[3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-phenylcarbamate (PubChem CID 11800701) has the molecular formula C31H28N2O5
and a molecular weight of 508.57 g/mol. Its IUPAC name is [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-phenylcarbamate.
Molecular Properties
| Compound Name | [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-phenylcarbamate |
| PubChem CID | 11800701 |
| Molecular Formula | C31H28N2O5 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-phenylcarbamate |
| SMILES | CN(CCCOc1ccc2c(=O)c3ccccc3oc2c1)Cc1cccc(OC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C31H28N2O5/c1-33(21-22-9-7-12-25(19-22)37-31(35)32-23-10-3-2-4-11-23)17-8-18-36-24-15-16-27-29(20-24)38-28-14-6-5-13-26(28)30(27)34/h2-7,9-16,19-20H,8,17-18,21H2,1H3,(H,32,35) |
| InChIKey | JLIDJRGQAIERBG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-phenylcarbamate?
The IUPAC name of [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-phenylcarbamate (CID 11800701) is [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-phenylcarbamate.
What is the SMILES notation for [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-phenylcarbamate?
The canonical SMILES for [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-phenylcarbamate is CN(CCCOc1ccc2c(=O)c3ccccc3oc2c1)Cc1cccc(OC(=O)Nc2ccccc2)c1.
What is the InChIKey of [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-phenylcarbamate?
The InChIKey is JLIDJRGQAIERBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H28N2O5/c1-33(21-22-9-7-12-25(19-22)37-31(35)32-23-10-3-2-4-11-23)17-8-18-36-24-15-16-27-29(20-24)38-28-14-6-5-13-26(28)30(27)34/h2-7,9-16,19-20H,8,17-18,21H2,1H3,(H,32,35).
What are the key properties of [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-phenylcarbamate?
[3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-phenylcarbamate has a molecular weight of 508.57 g/mol, XLogP of 6.46, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[methyl-[3-(9-oxoxanthen-3-yl)oxypropyl]amino]methyl]phenyl] N-phenylcarbamate is sourced from PubChem (CID 11800701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).