C17H18N4O2 — CID 118007139
(2R,6R)-4-(8-cyanoquinolin-5-yl)-N,6-dimethylmorpholine-2-carboxamide (PubChem CID 118007139) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is (2R,6R)-4-(8-cyanoquinolin-5-yl)-N,6-dimethylmorpholine-2-carboxamide.
| Compound Name | (2R,6R)-4-(8-cyanoquinolin-5-yl)-N,6-dimethylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 118007139 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (2R,6R)-4-(8-cyanoquinolin-5-yl)-N,6-dimethylmorpholine-2-carboxamide |
| SMILES | CNC(=O)[C@H]1CN(c2ccc(C#N)c3ncccc23)C[C@@H](C)O1 |
| InChI | InChI=1S/C17H18N4O2/c1-11-9-21(10-15(23-11)17(22)19-2)14-6-5-12(8-18)16-13(14)4-3-7-20-16/h3-7,11,15H,9-10H2,1-2H3,(H,19,22)/t11-,15-/m1/s1 |
| InChIKey | VRJVQZQAYSGRDT-IAQYHMDHSA-N |
| XLogP | 1.45 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |