C18H18N2O5S — CID 118007846
N-cyclopropylbenzamide;2-methoxy-N-sulfonylbenzamide (PubChem CID 118007846) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is N-cyclopropylbenzamide;2-methoxy-N-sulfonylbenzamide.
| Compound Name | N-cyclopropylbenzamide;2-methoxy-N-sulfonylbenzamide |
|---|---|
| PubChem CID | 118007846 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-cyclopropylbenzamide;2-methoxy-N-sulfonylbenzamide |
| SMILES | COc1ccccc1C(=O)N=S(=O)=O.O=C(NC1CC1)c1ccccc1 |
| InChI | InChI=1S/C10H11NO.C8H7NO4S/c12-10(11-9-6-7-9)8-4-2-1-3-5-8;1-13-7-5-3-2-4-6(7)8(10)9-14(11)12/h1-5,9H,6-7H2,(H,11,12);2-5H,1H3 |
| InChIKey | HFJHOIHMKWRVHA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |