About 1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridin-3-yloxyethanone
1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridin-3-yloxyethanone (PubChem CID 118007934) has the molecular formula C16H17N3O2
and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridin-3-yloxyethanone.
Molecular Properties
| Compound Name | 1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridin-3-yloxyethanone |
| PubChem CID | 118007934 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridin-3-yloxyethanone |
| SMILES | Nc1ccc2c(c1)CCN(C(=O)COc1cccnc1)C2 |
| InChI | InChI=1S/C16H17N3O2/c17-14-4-3-13-10-19(7-5-12(13)8-14)16(20)11-21-15-2-1-6-18-9-15/h1-4,6,8-9H,5,7,10-11,17H2 |
| InChIKey | BQNNQZJGOJXRPU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridin-3-yloxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridin-3-yloxyethanone?
The IUPAC name of 1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridin-3-yloxyethanone (CID 118007934) is 1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridin-3-yloxyethanone.
What is the SMILES notation for 1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridin-3-yloxyethanone?
The canonical SMILES for 1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridin-3-yloxyethanone is Nc1ccc2c(c1)CCN(C(=O)COc1cccnc1)C2.
What is the InChIKey of 1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridin-3-yloxyethanone?
The InChIKey is BQNNQZJGOJXRPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2/c17-14-4-3-13-10-19(7-5-12(13)8-14)16(20)11-21-15-2-1-6-18-9-15/h1-4,6,8-9H,5,7,10-11,17H2.
What are the key properties of 1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridin-3-yloxyethanone?
1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridin-3-yloxyethanone has a molecular weight of 283.33 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-pyridin-3-yloxyethanone is sourced from PubChem (CID 118007934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).