C31H54O6Si — CID 11800806
methyl (3R)-7-[(1S,2S,4aR,6R,8S,8aS)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxoheptanoate (PubChem CID 11800806) has the molecular formula C31H54O6Si and a molecular weight of 550.85 g/mol. Its IUPAC name is methyl (3R)-7-[(1S,2S,4aR,6R,8S,8aS)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxoheptanoate.
| Compound Name | methyl (3R)-7-[(1S,2S,4aR,6R,8S,8aS)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxoheptanoate |
|---|---|
| PubChem CID | 11800806 |
| Molecular Formula | C31H54O6Si |
| Molecular Weight | 550.85 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | methyl (3R)-7-[(1S,2S,4aR,6R,8S,8aS)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxoheptanoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@H](C)C[C@@H]2C=C[C@H](C)[C@H](CCC(=O)C[C@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C31H54O6Si/c1-11-21(3)30(34)36-27-17-20(2)16-23-13-12-22(4)26(29(23)27)15-14-24(32)18-25(19-28(33)35-8)37-38(9,10)31(5,6)7/h12-13,20-23,25-27,29H,11,14-19H2,1-10H3/t20-,21+,22+,23+,25-,26+,27+,29+/m1/s1 |
| InChIKey | FXSFOZBGIIBZGO-FTLTYSRRSA-N |
| XLogP | 7.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.85 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|