About 3-amino-5-(1,3-oxazol-2-yl)phenol
3-amino-5-(1,3-oxazol-2-yl)phenol (PubChem CID 118008600) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is 3-amino-5-(1,3-oxazol-2-yl)phenol.
Molecular Properties
| Compound Name | 3-amino-5-(1,3-oxazol-2-yl)phenol |
| PubChem CID | 118008600 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 3-amino-5-(1,3-oxazol-2-yl)phenol |
| SMILES | Nc1cc(O)cc(-c2ncco2)c1 |
| InChI | InChI=1S/C9H8N2O2/c10-7-3-6(4-8(12)5-7)9-11-1-2-13-9/h1-5,12H,10H2 |
| InChIKey | CENFBNIKKPTBQS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-(1,3-oxazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-(1,3-oxazol-2-yl)phenol?
The IUPAC name of 3-amino-5-(1,3-oxazol-2-yl)phenol (CID 118008600) is 3-amino-5-(1,3-oxazol-2-yl)phenol.
What is the SMILES notation for 3-amino-5-(1,3-oxazol-2-yl)phenol?
The canonical SMILES for 3-amino-5-(1,3-oxazol-2-yl)phenol is Nc1cc(O)cc(-c2ncco2)c1.
What is the InChIKey of 3-amino-5-(1,3-oxazol-2-yl)phenol?
The InChIKey is CENFBNIKKPTBQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c10-7-3-6(4-8(12)5-7)9-11-1-2-13-9/h1-5,12H,10H2.
What are the key properties of 3-amino-5-(1,3-oxazol-2-yl)phenol?
3-amino-5-(1,3-oxazol-2-yl)phenol has a molecular weight of 176.17 g/mol, XLogP of 1.63, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-(1,3-oxazol-2-yl)phenol is sourced from PubChem (CID 118008600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).