C22H19F2NO3 — CID 118008653
(4R,5R)-4-[3-[2-(3,3-difluorocyclobutyl)ethynyl]phenyl]-5-(3-methoxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 118008653) has the molecular formula C22H19F2NO3 and a molecular weight of 383.39 g/mol. Its IUPAC name is (4R,5R)-4-[3-[2-(3,3-difluorocyclobutyl)ethynyl]phenyl]-5-(3-methoxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-4-[3-[2-(3,3-difluorocyclobutyl)ethynyl]phenyl]-5-(3-methoxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 118008653 |
| Molecular Formula | C22H19F2NO3 |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (4R,5R)-4-[3-[2-(3,3-difluorocyclobutyl)ethynyl]phenyl]-5-(3-methoxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | COc1cccc([C@H]2OC(=O)N[C@@H]2c2cccc(C#CC3CC(F)(F)C3)c2)c1 |
| InChI | InChI=1S/C22H19F2NO3/c1-27-18-7-3-6-17(11-18)20-19(25-21(26)28-20)16-5-2-4-14(10-16)8-9-15-12-22(23,24)13-15/h2-7,10-11,15,19-20H,12-13H2,1H3,(H,25,26)/t19-,20-/m1/s1 |
| InChIKey | DWQZKVFZEOKMKA-WOJBJXKFSA-N |
| XLogP | 4.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|