C23H28N8S — CID 118008699
5-[(4-aminopiperidin-1-yl)methyl]-N-[3-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 118008699) has the molecular formula C23H28N8S and a molecular weight of 448.60 g/mol. Its IUPAC name is 5-[(4-aminopiperidin-1-yl)methyl]-N-[3-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-[(4-aminopiperidin-1-yl)methyl]-N-[3-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 118008699 |
| Molecular Formula | C23H28N8S |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 5-[(4-aminopiperidin-1-yl)methyl]-N-[3-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CC(C)c1nnc(-c2cccc(Nc3ncnn4ccc(CN5CCC(N)CC5)c34)c2)s1 |
| InChI | InChI=1S/C23H28N8S/c1-15(2)22-28-29-23(32-22)16-4-3-5-19(12-16)27-21-20-17(6-11-31(20)26-14-25-21)13-30-9-7-18(24)8-10-30/h3-6,11-12,14-15,18H,7-10,13,24H2,1-2H3,(H,25,26,27) |
| InChIKey | XEPJRTLAIQBJBK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |