C28H32F2N4O3S2 — CID 118008741
trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[2-(3,3-difluorocyclobutyl)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]cyclohexane-1-carboxamide (PubChem CID 118008741) has the molecular formula C28H32F2N4O3S2 and a molecular weight of 574.72 g/mol. Its IUPAC name is trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[2-(3,3-difluorocyclobutyl)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]cyclohexane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[2-(3,3-difluorocyclobutyl)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118008741 |
| Molecular Formula | C28H32F2N4O3S2 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[2-(3,3-difluorocyclobutyl)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]cyclohexane-1-carboxamide |
| SMILES | N#CC1(NC(=O)[C@@H]2CCCC[C@H]2c2nc(C3CC(F)(F)C3)sc2-c2ccc(N3CCS(=O)(=O)CC3)cc2)CC1 |
| InChI | InChI=1S/C28H32F2N4O3S2/c29-28(30)15-19(16-28)26-32-23(21-3-1-2-4-22(21)25(35)33-27(17-31)9-10-27)24(38-26)18-5-7-20(8-6-18)34-11-13-39(36,37)14-12-34/h5-8,19,21-22H,1-4,9-16H2,(H,33,35)/t21-,22-/m1/s1 |
| InChIKey | IEHUOCKBTQPTDD-FGZHOGPDSA-N |
| XLogP | 5.00 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |