C30H30ClN5O3S2 — CID 118008914
(1R,3R,4R,6S)-4-[2-(5-chloro-3-pyridinyl)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]-N-(1-cyanocyclopropyl)bicyclo[4.1.0]heptane-3-carboxamide (PubChem CID 118008914) has the molecular formula C30H30ClN5O3S2 and a molecular weight of 608.19 g/mol. Its IUPAC name is (1R,3R,4R,6S)-4-[2-(5-chloro-3-pyridinyl)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]-N-(1-cyanocyclopropyl)bicyclo[4.1.0]heptane-3-carboxamide.
| Compound Name | (1R,3R,4R,6S)-4-[2-(5-chloro-3-pyridinyl)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]-N-(1-cyanocyclopropyl)bicyclo[4.1.0]heptane-3-carboxamide |
|---|---|
| PubChem CID | 118008914 |
| Molecular Formula | C30H30ClN5O3S2 |
| Molecular Weight | 608.19 g/mol |
| Exact Mass | 607.15 |
| IUPAC Name | (1R,3R,4R,6S)-4-[2-(5-chloro-3-pyridinyl)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]-N-(1-cyanocyclopropyl)bicyclo[4.1.0]heptane-3-carboxamide |
| SMILES | N#CC1(NC(=O)[C@@H]2C[C@H]3C[C@H]3C[C@H]2c2nc(-c3cncc(Cl)c3)sc2-c2ccc(N3CCS(=O)(=O)CC3)cc2)CC1 |
| InChI | InChI=1S/C30H30ClN5O3S2/c31-22-12-21(15-33-16-22)29-34-26(24-13-19-11-20(19)14-25(24)28(37)35-30(17-32)5-6-30)27(40-29)18-1-3-23(4-2-18)36-7-9-41(38,39)10-8-36/h1-4,12,15-16,19-20,24-25H,5-11,13-14H2,(H,35,37)/t19-,20+,24+,25+/m0/s1 |
| InChIKey | CELAGYYIUKFWFT-MFVTWZDWSA-N |
| XLogP | 5.06 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.19 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |