C29H31F2N5O3S2 — CID 118008928
(1R,2R,5S)-N-(1-cyanocyclopropyl)-2-[5-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-3-pyridinyl)-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide (PubChem CID 118008928) has the molecular formula C29H31F2N5O3S2 and a molecular weight of 599.73 g/mol. Its IUPAC name is (1R,2R,5S)-N-(1-cyanocyclopropyl)-2-[5-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-3-pyridinyl)-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide.
| Compound Name | (1R,2R,5S)-N-(1-cyanocyclopropyl)-2-[5-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-3-pyridinyl)-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118008928 |
| Molecular Formula | C29H31F2N5O3S2 |
| Molecular Weight | 599.73 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | (1R,2R,5S)-N-(1-cyanocyclopropyl)-2-[5-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-3-pyridinyl)-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide |
| SMILES | N#CC1(NC(=O)[C@@H]2C[C@@H](F)CC[C@H]2c2nc(-c3cncc(F)c3)sc2-c2ccc(N3CCS(O)(O)CC3)cc2)CC1 |
| InChI | InChI=1S/C29H31F2N5O3S2/c30-20-3-6-23(24(14-20)27(37)35-29(17-32)7-8-29)25-26(40-28(34-25)19-13-21(31)16-33-15-19)18-1-4-22(5-2-18)36-9-11-41(38,39)12-10-36/h1-2,4-5,13,15-16,20,23-24,38-39H,3,6-12,14H2,(H,35,37)/t20-,23+,24+/m0/s1 |
| InChIKey | LNBJNUBLQGWGQE-TUACAJSNSA-N |
| XLogP | 5.98 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.73 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |