C27H30F4N4O3S2 — CID 118009063
(1R,2R,5S)-N-[(1S)-1-cyanoethyl]-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide (PubChem CID 118009063) has the molecular formula C27H30F4N4O3S2 and a molecular weight of 598.69 g/mol. Its IUPAC name is (1R,2R,5S)-N-[(1S)-1-cyanoethyl]-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide.
| Compound Name | (1R,2R,5S)-N-[(1S)-1-cyanoethyl]-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118009063 |
| Molecular Formula | C27H30F4N4O3S2 |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | (1R,2R,5S)-N-[(1S)-1-cyanoethyl]-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide |
| SMILES | C[C@@H](C#N)NC(=O)[C@@H]1C[C@@H](F)CC[C@H]1c1nc(C2(C(F)(F)F)CC2)sc1-c1ccc(N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C27H30F4N4O3S2/c1-16(15-32)33-24(36)21-14-18(28)4-7-20(21)22-23(39-25(34-22)26(8-9-26)27(29,30)31)17-2-5-19(6-3-17)35-10-12-40(37,38)13-11-35/h2-3,5-6,16,18,20-21H,4,7-14H2,1H3,(H,33,36)/t16-,18-,20+,21+/m0/s1 |
| InChIKey | HKJVYMXSVIHVAH-XIGKFDRGSA-N |
| XLogP | 4.89 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |